3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid

C16H14O3 — CID 116927154

IUPAC3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid
SMILESO=C(O)c1cccc(Cc2ccc3c(c2)CCO3)c1
InChIInChI=1S/C16H14O3/c17-16(18)14-3-1-2-11(10-14)8-12-4-5-15-13(9-12)6-7-19-15/h1-5,9-10H,6-8H2,(H,17,18)
InChIKeyJFSNAOAGHFEXQT-UHFFFAOYSA-N
MW254.28 g/mol
LogP2.91
Rot. Bonds3

About 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid

3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid (PubChem CID 116927154) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid.

Molecular Properties

Compound Name3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid
PubChem CID116927154
Molecular FormulaC16H14O3
Molecular Weight254.28 g/mol
Exact Mass254.09
IUPAC Name3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid
SMILESO=C(O)c1cccc(Cc2ccc3c(c2)CCO3)c1
InChIInChI=1S/C16H14O3/c17-16(18)14-3-1-2-11(10-14)8-12-4-5-15-13(9-12)6-7-19-15/h1-5,9-10H,6-8H2,(H,17,18)
InChIKeyJFSNAOAGHFEXQT-UHFFFAOYSA-N
XLogP2.91
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.28
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid?
The IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid (CID 116927154) is 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid.
What is the SMILES notation for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid?
The canonical SMILES for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid is O=C(O)c1cccc(Cc2ccc3c(c2)CCO3)c1.
What is the InChIKey of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid?
The InChIKey is JFSNAOAGHFEXQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c17-16(18)14-3-1-2-11(10-14)8-12-4-5-15-13(9-12)6-7-19-15/h1-5,9-10H,6-8H2,(H,17,18).
What are the key properties of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid?
3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid has a molecular weight of 254.28 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)benzoic acid is sourced from PubChem (CID 116927154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).