C25H35ClN2O5S — CID 174474749
5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-N,N-dimethyl-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride (PubChem CID 174474749) has the molecular formula C25H35ClN2O5S and a molecular weight of 511.08 g/mol. Its IUPAC name is 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-N,N-dimethyl-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride.
| Compound Name | 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-N,N-dimethyl-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 174474749 |
| Molecular Formula | C25H35ClN2O5S |
| Molecular Weight | 511.08 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-N,N-dimethyl-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride |
| SMILES | COc1ccccc1CCCNCCCCC(=O)c1cc2c(c(S(=O)(=O)N(C)C)c1)OCC2.Cl |
| InChI | InChI=1S/C25H34N2O5S.ClH/c1-27(2)33(29,30)24-18-21(17-20-13-16-32-25(20)24)22(28)11-6-7-14-26-15-8-10-19-9-4-5-12-23(19)31-3;/h4-5,9,12,17-18,26H,6-8,10-11,13-16H2,1-3H3;1H |
| InChIKey | YRAUTUFLPWVQBX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.08 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|