C24H31N3O3 — CID 11575101
5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 11575101) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 11575101 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-[5-[3-(2-methoxyphenyl)propylamino]pentanoyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | COc1ccccc1CCCNCCCCC(=O)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C24H31N3O3/c1-26-20-14-13-19(17-21(20)27(2)24(26)29)22(28)11-6-7-15-25-16-8-10-18-9-4-5-12-23(18)30-3/h4-5,9,12-14,17,25H,6-8,10-11,15-16H2,1-3H3 |
| InChIKey | WBZJKVUWWYAYNU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|