C27H35N3O4 — CID 90699319
[5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl] N-tert-butyl-N-(2-phenylethyl)carbamate (PubChem CID 90699319) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl] N-tert-butyl-N-(2-phenylethyl)carbamate.
| Compound Name | [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl] N-tert-butyl-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 90699319 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl] N-tert-butyl-N-(2-phenylethyl)carbamate |
| SMILES | Cn1c(=O)n(C)c2cc(C(=O)CCCCOC(=O)N(CCc3ccccc3)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C27H35N3O4/c1-27(2,3)30(17-16-20-11-7-6-8-12-20)26(33)34-18-10-9-13-24(31)21-14-15-22-23(19-21)29(5)25(32)28(22)4/h6-8,11-12,14-15,19H,9-10,13,16-18H2,1-5H3 |
| InChIKey | TUZWTFXDCZBLJY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|