About 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate
2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate (PubChem CID 175013804) has the molecular formula C20H30F2N2O2
and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate.
Molecular Properties
| Compound Name | 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate |
| PubChem CID | 175013804 |
| Molecular Formula | C20H30F2N2O2 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate |
| SMILES | CC(C)(C)N(CCc1ccccc1)C(=O)OCCN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C20H30F2N2O2/c1-19(2,3)24(13-10-17-8-5-4-6-9-17)18(25)26-15-14-23-12-7-11-20(21,22)16-23/h4-6,8-9H,7,10-16H2,1-3H3 |
| InChIKey | AUBJZZHMADNVFO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate?
The IUPAC name of 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate (CID 175013804) is 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate.
What is the SMILES notation for 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate?
The canonical SMILES for 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate is CC(C)(C)N(CCc1ccccc1)C(=O)OCCN1CCCC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate?
The InChIKey is AUBJZZHMADNVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F2N2O2/c1-19(2,3)24(13-10-17-8-5-4-6-9-17)18(25)26-15-14-23-12-7-11-20(21,22)16-23/h4-6,8-9H,7,10-16H2,1-3H3.
What are the key properties of 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate?
2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate has a molecular weight of 368.47 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropiperidin-1-yl)ethyl N-tert-butyl-N-(2-phenylethyl)carbamate is sourced from PubChem (CID 175013804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).