C15H20F3NO2 — CID 175012156
2,2,2-trifluoroethyl N-tert-butyl-N-(2-phenylethyl)carbamate (PubChem CID 175012156) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-tert-butyl-N-(2-phenylethyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-tert-butyl-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 175012156 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2,2,2-trifluoroethyl N-tert-butyl-N-(2-phenylethyl)carbamate |
| SMILES | CC(C)(C)N(CCc1ccccc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C15H20F3NO2/c1-14(2,3)19(13(20)21-11-15(16,17)18)10-9-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3 |
| InChIKey | VDESPIVAUQGMQA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |