C13H16F3NO3 — CID 65168993
2,2,2-trifluoroethyl N-methyl-N-(3-phenoxypropyl)carbamate (PubChem CID 65168993) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-methyl-N-(3-phenoxypropyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-methyl-N-(3-phenoxypropyl)carbamate |
|---|---|
| PubChem CID | 65168993 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2,2,2-trifluoroethyl N-methyl-N-(3-phenoxypropyl)carbamate |
| SMILES | CN(CCCOc1ccccc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3/c1-17(12(18)20-10-13(14,15)16)8-5-9-19-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | GYAGIPBYPXPNPN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|