C20H23F3N2O4 — CID 112825655
3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-1-methyl-1-(3-phenoxypropyl)urea (PubChem CID 112825655) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is 3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-1-methyl-1-(3-phenoxypropyl)urea.
| Compound Name | 3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-1-methyl-1-(3-phenoxypropyl)urea |
|---|---|
| PubChem CID | 112825655 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-1-methyl-1-(3-phenoxypropyl)urea |
| SMILES | COc1ccc(NC(=O)N(C)CCCOc2ccccc2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O4/c1-25(11-6-12-28-16-7-4-3-5-8-16)19(26)24-15-9-10-17(27-2)18(13-15)29-14-20(21,22)23/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H,24,26) |
| InChIKey | JCPBKTOQDMZSJO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|