C24H33N3O2 — CID 175009433
2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]ethyl N-benzyl-N-(2-phenylethyl)carbamate (PubChem CID 175009433) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]ethyl N-benzyl-N-(2-phenylethyl)carbamate.
| Compound Name | 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]ethyl N-benzyl-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 175009433 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]ethyl N-benzyl-N-(2-phenylethyl)carbamate |
| SMILES | CN(C)[C@H]1CCN(CCOC(=O)N(CCc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H33N3O2/c1-25(2)23-14-15-26(20-23)17-18-29-24(28)27(19-22-11-7-4-8-12-22)16-13-21-9-5-3-6-10-21/h3-12,23H,13-20H2,1-2H3/t23-/m0/s1 |
| InChIKey | DPIPUVWGKGVLRP-QHCPKHFHSA-N |
| XLogP | 3.50 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |