C20H27IN2O2 — CID 21119463
2-(dimethylamino)ethyl N,N-dibenzylcarbamate;iodomethane (PubChem CID 21119463) has the molecular formula C20H27IN2O2 and a molecular weight of 454.35 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N,N-dibenzylcarbamate;iodomethane.
| Compound Name | 2-(dimethylamino)ethyl N,N-dibenzylcarbamate;iodomethane |
|---|---|
| PubChem CID | 21119463 |
| Molecular Formula | C20H27IN2O2 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-(dimethylamino)ethyl N,N-dibenzylcarbamate;iodomethane |
| SMILES | CI.CN(C)CCOC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O2.CH3I/c1-20(2)13-14-23-19(22)21(15-17-9-5-3-6-10-17)16-18-11-7-4-8-12-18;1-2/h3-12H,13-16H2,1-2H3;1H3 |
| InChIKey | OAYMAWYNKKMTNS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|