C15H23NO2 — CID 11096967
2-phenylethyl N,N-dipropylcarbamate (PubChem CID 11096967) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-phenylethyl N,N-dipropylcarbamate.
| Compound Name | 2-phenylethyl N,N-dipropylcarbamate |
|---|---|
| PubChem CID | 11096967 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-phenylethyl N,N-dipropylcarbamate |
| SMILES | CCCN(CCC)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-3-11-16(12-4-2)15(17)18-13-10-14-8-6-5-7-9-14/h5-9H,3-4,10-13H2,1-2H3 |
| InChIKey | DVUBRCTUVDJOOT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |