About 2-phenylethyl acetate
2-phenylethyl acetate (PubChem CID 7654) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-phenylethyl acetate.
Molecular Properties
| Compound Name | 2-phenylethyl acetate |
| PubChem CID | 7654 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-phenylethyl acetate |
| SMILES | CC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C10H12O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | MDHYEMXUFSJLGV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl acetate?
The IUPAC name of 2-phenylethyl acetate (CID 7654) is 2-phenylethyl acetate.
What is the SMILES notation for 2-phenylethyl acetate?
The canonical SMILES for 2-phenylethyl acetate is CC(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl acetate?
The InChIKey is MDHYEMXUFSJLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of 2-phenylethyl acetate?
2-phenylethyl acetate has a molecular weight of 164.20 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl acetate is sourced from PubChem (CID 7654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).