About (3-oxo-7-phenylheptyl) acetate
(3-oxo-7-phenylheptyl) acetate (PubChem CID 175000203) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is (3-oxo-7-phenylheptyl) acetate.
Molecular Properties
| Compound Name | (3-oxo-7-phenylheptyl) acetate |
| PubChem CID | 175000203 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3-oxo-7-phenylheptyl) acetate |
| SMILES | CC(=O)OCCC(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-13(16)18-12-11-15(17)10-6-5-9-14-7-3-2-4-8-14/h2-4,7-8H,5-6,9-12H2,1H3 |
| InChIKey | XYNHMLKTCMLFFR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-7-phenylheptyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-7-phenylheptyl) acetate?
The IUPAC name of (3-oxo-7-phenylheptyl) acetate (CID 175000203) is (3-oxo-7-phenylheptyl) acetate.
What is the SMILES notation for (3-oxo-7-phenylheptyl) acetate?
The canonical SMILES for (3-oxo-7-phenylheptyl) acetate is CC(=O)OCCC(=O)CCCCc1ccccc1.
What is the InChIKey of (3-oxo-7-phenylheptyl) acetate?
The InChIKey is XYNHMLKTCMLFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-13(16)18-12-11-15(17)10-6-5-9-14-7-3-2-4-8-14/h2-4,7-8H,5-6,9-12H2,1H3.
What are the key properties of (3-oxo-7-phenylheptyl) acetate?
(3-oxo-7-phenylheptyl) acetate has a molecular weight of 248.32 g/mol, XLogP of 2.92, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-7-phenylheptyl) acetate is sourced from PubChem (CID 175000203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).