About N,N-dimethylmethanamine;2-phenylethyl acetate
N,N-dimethylmethanamine;2-phenylethyl acetate (PubChem CID 67859846) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-phenylethyl acetate.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;2-phenylethyl acetate |
| PubChem CID | 67859846 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N,N-dimethylmethanamine;2-phenylethyl acetate |
| SMILES | CC(=O)OCCc1ccccc1.CN(C)C |
| InChI | InChI=1S/C10H12O2.C3H9N/c1-9(11)12-8-7-10-5-3-2-4-6-10;1-4(2)3/h2-6H,7-8H2,1H3;1-3H3 |
| InChIKey | FWJITWQYGGHVBE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylmethanamine;2-phenylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;2-phenylethyl acetate?
The IUPAC name of N,N-dimethylmethanamine;2-phenylethyl acetate (CID 67859846) is N,N-dimethylmethanamine;2-phenylethyl acetate.
What is the SMILES notation for N,N-dimethylmethanamine;2-phenylethyl acetate?
The canonical SMILES for N,N-dimethylmethanamine;2-phenylethyl acetate is CC(=O)OCCc1ccccc1.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;2-phenylethyl acetate?
The InChIKey is FWJITWQYGGHVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C3H9N/c1-9(11)12-8-7-10-5-3-2-4-6-10;1-4(2)3/h2-6H,7-8H2,1H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;2-phenylethyl acetate?
N,N-dimethylmethanamine;2-phenylethyl acetate has a molecular weight of 223.32 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;2-phenylethyl acetate is sourced from PubChem (CID 67859846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).