About 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate
2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate (PubChem CID 11401868) has the molecular formula C12H12F2O2
and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate |
| PubChem CID | 11401868 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate |
| SMILES | CC(C(=O)OCCc1ccccc1)=C(F)F |
| InChI | InChI=1S/C12H12F2O2/c1-9(11(13)14)12(15)16-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | NAUZSQINZKJVFN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate?
The IUPAC name of 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate (CID 11401868) is 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate.
What is the SMILES notation for 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate?
The canonical SMILES for 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate is CC(C(=O)OCCc1ccccc1)=C(F)F.
What is the InChIKey of 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate?
The InChIKey is NAUZSQINZKJVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O2/c1-9(11(13)14)12(15)16-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate?
2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate has a molecular weight of 226.22 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 3,3-difluoro-2-methylprop-2-enoate is sourced from PubChem (CID 11401868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).