C20H22O6 — CID 70936130
bis(2-phenylethyl) (2S,3S)-2,3-dihydroxybutanedioate (PubChem CID 70936130) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is bis(2-phenylethyl) (2S,3S)-2,3-dihydroxybutanedioate.
| Compound Name | bis(2-phenylethyl) (2S,3S)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 70936130 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | bis(2-phenylethyl) (2S,3S)-2,3-dihydroxybutanedioate |
| SMILES | O=C(OCCc1ccccc1)[C@@H](O)[C@H](O)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C20H22O6/c21-17(19(23)25-13-11-15-7-3-1-4-8-15)18(22)20(24)26-14-12-16-9-5-2-6-10-16/h1-10,17-18,21-22H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | FOOKSOWEDRZEBZ-ROUUACIJSA-N |
| XLogP | 1.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |