C13H16O6 — CID 141000752
(2R,3R)-2,3-dihydroxy-4-oxo-4-(3-phenylpropoxy)butanoic acid (PubChem CID 141000752) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-4-oxo-4-(3-phenylpropoxy)butanoic acid.
| Compound Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-(3-phenylpropoxy)butanoic acid |
|---|---|
| PubChem CID | 141000752 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-(3-phenylpropoxy)butanoic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C13H16O6/c14-10(12(16)17)11(15)13(18)19-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,10-11,14-15H,4,7-8H2,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | MGAJHAXGNUSCPF-GHMZBOCLSA-N |
| XLogP | -0.03 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|