About 8-phenyloctyl carbamate
8-phenyloctyl carbamate (PubChem CID 67180735) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 8-phenyloctyl carbamate.
Molecular Properties
| Compound Name | 8-phenyloctyl carbamate |
| PubChem CID | 67180735 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 8-phenyloctyl carbamate |
| SMILES | NC(=O)OCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c16-15(17)18-13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-8,11-12H,1-4,6,9-10,13H2,(H2,16,17) |
| InChIKey | GKTQCACRARIZGT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-phenyloctyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyloctyl carbamate?
The IUPAC name of 8-phenyloctyl carbamate (CID 67180735) is 8-phenyloctyl carbamate.
What is the SMILES notation for 8-phenyloctyl carbamate?
The canonical SMILES for 8-phenyloctyl carbamate is NC(=O)OCCCCCCCCc1ccccc1.
What is the InChIKey of 8-phenyloctyl carbamate?
The InChIKey is GKTQCACRARIZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c16-15(17)18-13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-8,11-12H,1-4,6,9-10,13H2,(H2,16,17).
What are the key properties of 8-phenyloctyl carbamate?
8-phenyloctyl carbamate has a molecular weight of 249.35 g/mol, XLogP of 3.66, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyloctyl carbamate is sourced from PubChem (CID 67180735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).