C15H23NO5 — CID 70682052
N,N-dimethyl-2-(3-phenylpropoxy)ethanamine;oxalic acid (PubChem CID 70682052) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-phenylpropoxy)ethanamine;oxalic acid.
| Compound Name | N,N-dimethyl-2-(3-phenylpropoxy)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 70682052 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N,N-dimethyl-2-(3-phenylpropoxy)ethanamine;oxalic acid |
| SMILES | CN(C)CCOCCCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H21NO.C2H2O4/c1-14(2)10-12-15-11-6-9-13-7-4-3-5-8-13;3-1(4)2(5)6/h3-5,7-8H,6,9-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | RCBJAKOQFKBIHT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|