C11H18N2O3 — CID 173132707
N,N-dimethyl-3-phenylpropan-1-amine;nitric acid (PubChem CID 173132707) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is N,N-dimethyl-3-phenylpropan-1-amine;nitric acid.
| Compound Name | N,N-dimethyl-3-phenylpropan-1-amine;nitric acid |
|---|---|
| PubChem CID | 173132707 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N,N-dimethyl-3-phenylpropan-1-amine;nitric acid |
| SMILES | CN(C)CCCc1ccccc1.O=[N+]([O-])O |
| InChI | InChI=1S/C11H17N.HNO3/c1-12(2)10-6-9-11-7-4-3-5-8-11;2-1(3)4/h3-5,7-8H,6,9-10H2,1-2H3;(H,2,3,4) |
| InChIKey | PDUDRFBBCVPBPX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|