C19H24N4O7 — CID 71389972
N,N-dimethyl-5-phenylpentan-1-amine;2,4,6-trinitrophenol (PubChem CID 71389972) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is N,N-dimethyl-5-phenylpentan-1-amine;2,4,6-trinitrophenol.
| Compound Name | N,N-dimethyl-5-phenylpentan-1-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71389972 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N,N-dimethyl-5-phenylpentan-1-amine;2,4,6-trinitrophenol |
| SMILES | CN(C)CCCCCc1ccccc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H21N.C6H3N3O7/c1-14(2)12-8-4-7-11-13-9-5-3-6-10-13;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3;1-2,10H |
| InChIKey | YHQIZCMYRSENMM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|