C16H15N3O7 — CID 175210852
1,3,5-trinitro-2-(4-phenylbutoxy)benzene (PubChem CID 175210852) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is 1,3,5-trinitro-2-(4-phenylbutoxy)benzene.
| Compound Name | 1,3,5-trinitro-2-(4-phenylbutoxy)benzene |
|---|---|
| PubChem CID | 175210852 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1,3,5-trinitro-2-(4-phenylbutoxy)benzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(OCCCCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O7/c20-17(21)13-10-14(18(22)23)16(15(11-13)19(24)25)26-9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2 |
| InChIKey | AFLACODEHSUDJP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|