C20H22N4O9 — CID 140975215
1-[4-[4-(2,4-dinitrophenyl)butoxy]butyl]-2,4-dinitrobenzene (PubChem CID 140975215) has the molecular formula C20H22N4O9 and a molecular weight of 462.42 g/mol. Its IUPAC name is 1-[4-[4-(2,4-dinitrophenyl)butoxy]butyl]-2,4-dinitrobenzene.
| Compound Name | 1-[4-[4-(2,4-dinitrophenyl)butoxy]butyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 140975215 |
| Molecular Formula | C20H22N4O9 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[4-[4-(2,4-dinitrophenyl)butoxy]butyl]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(CCCCOCCCCc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N4O9/c25-21(26)17-9-7-15(19(13-17)23(29)30)5-1-3-11-33-12-4-2-6-16-8-10-18(22(27)28)14-20(16)24(31)32/h7-10,13-14H,1-6,11-12H2 |
| InChIKey | VYLXMOHOTIYZEV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|