C37H53FN2O15 — CID 158637650
(E)-4-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]but-3-en-2-one (PubChem CID 158637650) has the molecular formula C37H53FN2O15 and a molecular weight of 784.83 g/mol. Its IUPAC name is (E)-4-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]but-3-en-2-one.
| Compound Name | (E)-4-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158637650 |
| Molecular Formula | C37H53FN2O15 |
| Molecular Weight | 784.83 g/mol |
| Exact Mass | 784.34 |
| IUPAC Name | (E)-4-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cc(F)cc(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCCc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H53FN2O15/c1-31(41)4-5-32-27-34(38)29-36(28-32)55-26-25-54-24-23-53-22-21-52-20-19-51-18-17-50-16-15-49-14-13-48-12-11-47-10-9-46-8-2-3-33-6-7-35(39(42)43)30-37(33)40(44)45/h4-7,27-30H,2-3,8-26H2,1H3/b5-4+ |
| InChIKey | HZYXOBSUWAJDMX-SNAWJCMRSA-N |
| XLogP | 4.41 |
| TPSA | 195.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|