C37H65N2O20P — CID 159675272
2-[[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-hydroxyphosphoryl]methyl]pentanoic acid (PubChem CID 159675272) has the molecular formula C37H65N2O20P and a molecular weight of 888.89 g/mol. Its IUPAC name is 2-[[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-hydroxyphosphoryl]methyl]pentanoic acid.
| Compound Name | 2-[[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-hydroxyphosphoryl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 159675272 |
| Molecular Formula | C37H65N2O20P |
| Molecular Weight | 888.89 g/mol |
| Exact Mass | 888.39 |
| IUPAC Name | 2-[[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-hydroxyphosphoryl]methyl]pentanoic acid |
| SMILES | CCCC(CP(=O)(O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C37H65N2O20P/c1-2-4-34(37(40)41)32-60(46,47)59-30-29-58-28-27-57-26-25-56-24-23-55-22-21-54-20-19-53-18-17-52-16-15-51-14-13-50-12-11-49-10-9-48-8-3-5-33-6-7-35(38(42)43)31-36(33)39(44)45/h6-7,31,34H,2-5,8-30,32H2,1H3,(H,40,41)(H,46,47) |
| InChIKey | NVHZRXITRJEGSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 271.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|