C10H10N2O7 — CID 104875714
(2R)-2-[(2,4-dinitrophenyl)methoxy]propanoic acid (PubChem CID 104875714) has the molecular formula C10H10N2O7 and a molecular weight of 270.20 g/mol. Its IUPAC name is (2R)-2-[(2,4-dinitrophenyl)methoxy]propanoic acid.
| Compound Name | (2R)-2-[(2,4-dinitrophenyl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104875714 |
| Molecular Formula | C10H10N2O7 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | (2R)-2-[(2,4-dinitrophenyl)methoxy]propanoic acid |
| SMILES | C[C@@H](OCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H10N2O7/c1-6(10(13)14)19-5-7-2-3-8(11(15)16)4-9(7)12(17)18/h2-4,6H,5H2,1H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | DFCAHFWMNBIHHA-ZCFIWIBFSA-N |
| XLogP | 1.49 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|