C10H12N2O5 — CID 66223081
4-(2,4-dinitrophenyl)butan-2-ol (PubChem CID 66223081) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)butan-2-ol.
| Compound Name | 4-(2,4-dinitrophenyl)butan-2-ol |
|---|---|
| PubChem CID | 66223081 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-(2,4-dinitrophenyl)butan-2-ol |
| SMILES | CC(O)CCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O5/c1-7(13)2-3-8-4-5-9(11(14)15)6-10(8)12(16)17/h4-7,13H,2-3H2,1H3 |
| InChIKey | UKLAREPYLDVIHR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|