C11H14N2O5 — CID 86720802
5-(2,4-dinitrophenyl)pentan-1-ol (PubChem CID 86720802) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)pentan-1-ol.
| Compound Name | 5-(2,4-dinitrophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 86720802 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(2,4-dinitrophenyl)pentan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(CCCCCO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N2O5/c14-7-3-1-2-4-9-5-6-10(12(15)16)8-11(9)13(17)18/h5-6,8,14H,1-4,7H2 |
| InChIKey | HEFZUKIECQUUQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|