C12H17N3O7S — CID 23623566
bis(2-hydroxyethyl)azanium;2-(2,4-dinitrophenyl)ethanethioate (PubChem CID 23623566) has the molecular formula C12H17N3O7S and a molecular weight of 347.35 g/mol. Its IUPAC name is bis(2-hydroxyethyl)azanium;2-(2,4-dinitrophenyl)ethanethioate.
| Compound Name | bis(2-hydroxyethyl)azanium;2-(2,4-dinitrophenyl)ethanethioate |
|---|---|
| PubChem CID | 23623566 |
| Molecular Formula | C12H17N3O7S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | bis(2-hydroxyethyl)azanium;2-(2,4-dinitrophenyl)ethanethioate |
| SMILES | O=C([S-])Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].OCC[NH2+]CCO |
| InChI | InChI=1S/C8H6N2O5S.C4H11NO2/c11-8(16)3-5-1-2-6(9(12)13)4-7(5)10(14)15;6-3-1-5-2-4-7/h1-2,4H,3H2,(H,11,16);5-7H,1-4H2 |
| InChIKey | GPYBLXMDNWNDNB-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|