C9H9N3O5 — CID 5355471
(NZ)-N-[1-(2,4-dinitrophenyl)propan-2-ylidene]hydroxylamine (PubChem CID 5355471) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is (NZ)-N-[1-(2,4-dinitrophenyl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,4-dinitrophenyl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 5355471 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (NZ)-N-[1-(2,4-dinitrophenyl)propan-2-ylidene]hydroxylamine |
| SMILES | C/C(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])=N/O |
| InChI | InChI=1S/C9H9N3O5/c1-6(10-13)4-7-2-3-8(11(14)15)5-9(7)12(16)17/h2-3,5,13H,4H2,1H3/b10-6- |
| InChIKey | MZISWTHYYSCWSH-POHAHGRESA-N |
| XLogP | 1.90 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|