C8H5N3O4 — CID 5129344
2-(2,4-dinitrophenyl)acetonitrile (PubChem CID 5129344) has the molecular formula C8H5N3O4 and a molecular weight of 207.15 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)acetonitrile.
| Compound Name | 2-(2,4-dinitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 5129344 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2-(2,4-dinitrophenyl)acetonitrile |
| SMILES | N#CCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5N3O4/c9-4-3-6-1-2-7(10(12)13)5-8(6)11(14)15/h1-2,5H,3H2 |
| InChIKey | CWCDKZILBPYYPH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|