C8H6N2O4 — CID 10921393
2-(4,5-dihydroxy-2-nitrophenyl)acetonitrile (PubChem CID 10921393) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-2-nitrophenyl)acetonitrile.
| Compound Name | 2-(4,5-dihydroxy-2-nitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 10921393 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-(4,5-dihydroxy-2-nitrophenyl)acetonitrile |
| SMILES | N#CCc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N2O4/c9-2-1-5-3-7(11)8(12)4-6(5)10(13)14/h3-4,11-12H,1H2 |
| InChIKey | UBLFQBDSTJATJY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|