C9H12N2O4 — CID 131374132
4-(2-aminopropyl)-5-nitrobenzene-1,2-diol (PubChem CID 131374132) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-(2-aminopropyl)-5-nitrobenzene-1,2-diol.
| Compound Name | 4-(2-aminopropyl)-5-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 131374132 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-(2-aminopropyl)-5-nitrobenzene-1,2-diol |
| SMILES | CC(N)Cc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N2O4/c1-5(10)2-6-3-8(12)9(13)4-7(6)11(14)15/h3-5,12-13H,2,10H2,1H3 |
| InChIKey | NZGVEISRKHZYIP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|