C7H5ClN2O6S — CID 18411991
(2,4-dinitrophenyl)methanesulfonyl chloride (PubChem CID 18411991) has the molecular formula C7H5ClN2O6S and a molecular weight of 280.64 g/mol. Its IUPAC name is (2,4-dinitrophenyl)methanesulfonyl chloride.
| Compound Name | (2,4-dinitrophenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 18411991 |
| Molecular Formula | C7H5ClN2O6S |
| Molecular Weight | 280.64 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | (2,4-dinitrophenyl)methanesulfonyl chloride |
| SMILES | O=[N+]([O-])c1ccc(CS(=O)(=O)Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5ClN2O6S/c8-17(15,16)4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
| InChIKey | KWGQDPDGPTZKOS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.64 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|