C11H13N3O6S — CID 81198669
3-[(2,4-dinitrophenyl)methylsulfonylmethyl]azetidine (PubChem CID 81198669) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is 3-[(2,4-dinitrophenyl)methylsulfonylmethyl]azetidine.
| Compound Name | 3-[(2,4-dinitrophenyl)methylsulfonylmethyl]azetidine |
|---|---|
| PubChem CID | 81198669 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-[(2,4-dinitrophenyl)methylsulfonylmethyl]azetidine |
| SMILES | O=[N+]([O-])c1ccc(CS(=O)(=O)CC2CNC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O6S/c15-13(16)10-2-1-9(11(3-10)14(17)18)7-21(19,20)6-8-4-12-5-8/h1-3,8,12H,4-7H2 |
| InChIKey | ZOAMCSYVEBQSAI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|