C12H14N2O5 — CID 66223940
1-cyclopropyl-3-(2,4-dinitrophenyl)propan-1-ol (PubChem CID 66223940) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,4-dinitrophenyl)propan-1-ol.
| Compound Name | 1-cyclopropyl-3-(2,4-dinitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66223940 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-cyclopropyl-3-(2,4-dinitrophenyl)propan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(CCC(O)C2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O5/c15-12(9-1-2-9)6-4-8-3-5-10(13(16)17)7-11(8)14(18)19/h3,5,7,9,12,15H,1-2,4,6H2 |
| InChIKey | FJBROVNYBUESHK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|