C12H14ClNO3 — CID 63354831
3-(2-chloro-4-nitrophenyl)-1-cyclopropylpropan-1-ol (PubChem CID 63354831) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 3-(2-chloro-4-nitrophenyl)-1-cyclopropylpropan-1-ol.
| Compound Name | 3-(2-chloro-4-nitrophenyl)-1-cyclopropylpropan-1-ol |
|---|---|
| PubChem CID | 63354831 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2-chloro-4-nitrophenyl)-1-cyclopropylpropan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(CCC(O)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO3/c13-11-7-10(14(16)17)5-3-8(11)4-6-12(15)9-1-2-9/h3,5,7,9,12,15H,1-2,4,6H2 |
| InChIKey | BEJQEJARQPUMQO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|