C12H17N3O4 — CID 66221576
1-(2,4-dinitrophenyl)-N-methylpentan-3-amine (PubChem CID 66221576) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-N-methylpentan-3-amine.
| Compound Name | 1-(2,4-dinitrophenyl)-N-methylpentan-3-amine |
|---|---|
| PubChem CID | 66221576 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-N-methylpentan-3-amine |
| SMILES | CCC(CCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC |
| InChI | InChI=1S/C12H17N3O4/c1-3-10(13-2)6-4-9-5-7-11(14(16)17)8-12(9)15(18)19/h5,7-8,10,13H,3-4,6H2,1-2H3 |
| InChIKey | CBUAPMOWAZMMAS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|