C12H17BrN2O3 — CID 62319831
4-(2-bromo-4-nitrophenyl)-1-methoxy-N-methylbutan-2-amine (PubChem CID 62319831) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is 4-(2-bromo-4-nitrophenyl)-1-methoxy-N-methylbutan-2-amine.
| Compound Name | 4-(2-bromo-4-nitrophenyl)-1-methoxy-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 62319831 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-(2-bromo-4-nitrophenyl)-1-methoxy-N-methylbutan-2-amine |
| SMILES | CNC(CCc1ccc([N+](=O)[O-])cc1Br)COC |
| InChI | InChI=1S/C12H17BrN2O3/c1-14-10(8-18-2)5-3-9-4-6-11(15(16)17)7-12(9)13/h4,6-7,10,14H,3,5,8H2,1-2H3 |
| InChIKey | NMJBHLXSSQTMPT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|