C15H23BrN2O2 — CID 60995717
1-(2-bromo-4-nitrophenyl)-N-ethyl-4,4-dimethylpentan-3-amine (PubChem CID 60995717) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-(2-bromo-4-nitrophenyl)-N-ethyl-4,4-dimethylpentan-3-amine.
| Compound Name | 1-(2-bromo-4-nitrophenyl)-N-ethyl-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 60995717 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2-bromo-4-nitrophenyl)-N-ethyl-4,4-dimethylpentan-3-amine |
| SMILES | CCNC(CCc1ccc([N+](=O)[O-])cc1Br)C(C)(C)C |
| InChI | InChI=1S/C15H23BrN2O2/c1-5-17-14(15(2,3)4)9-7-11-6-8-12(18(19)20)10-13(11)16/h6,8,10,14,17H,5,7,9H2,1-4H3 |
| InChIKey | CIPNVKFKXPILOY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|