C14H21BrN2O2 — CID 83143763
N-[(2-bromo-4-nitrophenyl)methyl]-2,3,3-trimethylbutan-1-amine (PubChem CID 83143763) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is N-[(2-bromo-4-nitrophenyl)methyl]-2,3,3-trimethylbutan-1-amine.
| Compound Name | N-[(2-bromo-4-nitrophenyl)methyl]-2,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 83143763 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-[(2-bromo-4-nitrophenyl)methyl]-2,3,3-trimethylbutan-1-amine |
| SMILES | CC(CNCc1ccc([N+](=O)[O-])cc1Br)C(C)(C)C |
| InChI | InChI=1S/C14H21BrN2O2/c1-10(14(2,3)4)8-16-9-11-5-6-12(17(18)19)7-13(11)15/h5-7,10,16H,8-9H2,1-4H3 |
| InChIKey | DUBICYVXBGGMHE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|