C12H14BrF3N2O2 — CID 115518633
N-[(2-bromo-4-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115518633) has the molecular formula C12H14BrF3N2O2 and a molecular weight of 355.15 g/mol. Its IUPAC name is N-[(2-bromo-4-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(2-bromo-4-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115518633 |
| Molecular Formula | C12H14BrF3N2O2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N-[(2-bromo-4-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | O=[N+]([O-])c1ccc(CNCCCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrF3N2O2/c13-11-7-10(18(19)20)4-3-9(11)8-17-6-2-1-5-12(14,15)16/h3-4,7,17H,1-2,5-6,8H2 |
| InChIKey | DDAGHPWOFKSWAS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|