C13H18BrN3O3 — CID 106276928
3-[(2-bromo-4-nitrophenyl)methylamino]-N,2,2-trimethylpropanamide (PubChem CID 106276928) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-[(2-bromo-4-nitrophenyl)methylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2-bromo-4-nitrophenyl)methylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106276928 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-[(2-bromo-4-nitrophenyl)methylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNCc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H18BrN3O3/c1-13(2,12(18)15-3)8-16-7-9-4-5-10(17(19)20)6-11(9)14/h4-6,16H,7-8H2,1-3H3,(H,15,18) |
| InChIKey | LEBWOFPSXFBRNW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|