C13H15BrN2O6 — CID 120531771
2-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]-3-methoxy-2-methylpropanoic acid (PubChem CID 120531771) has the molecular formula C13H15BrN2O6 and a molecular weight of 375.18 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]-3-methoxy-2-methylpropanoic acid.
| Compound Name | 2-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]-3-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120531771 |
| Molecular Formula | C13H15BrN2O6 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 2-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]-3-methoxy-2-methylpropanoic acid |
| SMILES | COCC(C)(NC(=O)Cc1ccc([N+](=O)[O-])cc1Br)C(=O)O |
| InChI | InChI=1S/C13H15BrN2O6/c1-13(7-22-2,12(18)19)15-11(17)5-8-3-4-9(16(20)21)6-10(8)14/h3-4,6H,5,7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | VBMXJTXDGDNJIH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|