C14H17ClN2O5 — CID 120517024
2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-2-methylpentanoic acid (PubChem CID 120517024) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 120517024 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)Cc1ccc([N+](=O)[O-])cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17ClN2O5/c1-3-6-14(2,13(19)20)16-12(18)7-9-4-5-10(17(21)22)8-11(9)15/h4-5,8H,3,6-7H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | AYSLIGTYNVVGDC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|