C15H19ClN2O5 — CID 120533367
2-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]-2-ethylbutanoic acid (PubChem CID 120533367) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 120533367 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)Cc1ccc([N+](=O)[O-])cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H19ClN2O5/c1-3-15(4-2,14(20)21)9-17-13(19)7-10-5-6-11(18(22)23)8-12(10)16/h5-6,8H,3-4,7,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | RHYDMHLXOWAEJV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|