C17H24N2O5S — CID 120533439
2-ethyl-2-[[(5-nitro-2-propan-2-ylsulfanylbenzoyl)amino]methyl]butanoic acid (PubChem CID 120533439) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-ethyl-2-[[(5-nitro-2-propan-2-ylsulfanylbenzoyl)amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(5-nitro-2-propan-2-ylsulfanylbenzoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 120533439 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-ethyl-2-[[(5-nitro-2-propan-2-ylsulfanylbenzoyl)amino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1cc([N+](=O)[O-])ccc1SC(C)C)C(=O)O |
| InChI | InChI=1S/C17H24N2O5S/c1-5-17(6-2,16(21)22)10-18-15(20)13-9-12(19(23)24)7-8-14(13)25-11(3)4/h7-9,11H,5-6,10H2,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | AOVIGTZDAMBIRH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|