C12H11BrN2O5 — CID 120530481
1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclopropane-1-carboxylic acid (PubChem CID 120530481) has the molecular formula C12H11BrN2O5 and a molecular weight of 343.13 g/mol. Its IUPAC name is 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 120530481 |
| Molecular Formula | C12H11BrN2O5 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclopropane-1-carboxylic acid |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1Br)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C12H11BrN2O5/c13-9-6-8(15(19)20)2-1-7(9)5-10(16)14-12(3-4-12)11(17)18/h1-2,6H,3-5H2,(H,14,16)(H,17,18) |
| InChIKey | CLDRFJAOMQIHGJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|