C16H19ClN2O5 — CID 120539039
1-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]cycloheptane-1-carboxylic acid (PubChem CID 120539039) has the molecular formula C16H19ClN2O5 and a molecular weight of 354.79 g/mol. Its IUPAC name is 1-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539039 |
| Molecular Formula | C16H19ClN2O5 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]cycloheptane-1-carboxylic acid |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1Cl)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C16H19ClN2O5/c17-13-10-12(19(23)24)6-5-11(13)9-14(20)18-16(15(21)22)7-3-1-2-4-8-16/h5-6,10H,1-4,7-9H2,(H,18,20)(H,21,22) |
| InChIKey | ONAXCBRCGOBRTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|