C14H17N3O5 — CID 22503951
1-[(4-nitrophenyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 22503951) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-nitrophenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22503951 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[(4-nitrophenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H17N3O5/c18-12(19)14(8-2-1-3-9-14)16-13(20)15-10-4-6-11(7-5-10)17(21)22/h4-7H,1-3,8-9H2,(H,18,19)(H2,15,16,20) |
| InChIKey | SBTOAICTUKBJFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|